About 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane
2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane (PubChem CID 142886574) has the molecular formula C12H18F3NO
and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane.
Molecular Properties
| Compound Name | 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane |
| PubChem CID | 142886574 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane |
| SMILES | CF.CNCCOc1ccc(C(F)F)cc1C |
| InChI | InChI=1S/C11H15F2NO.CH3F/c1-8-7-9(11(12)13)3-4-10(8)15-6-5-14-2;1-2/h3-4,7,11,14H,5-6H2,1-2H3;1H3 |
| InChIKey | HWDBCOFMAFANKM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane?
The IUPAC name of 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane (CID 142886574) is 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane.
What is the SMILES notation for 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane?
The canonical SMILES for 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane is CF.CNCCOc1ccc(C(F)F)cc1C.
What is the InChIKey of 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane?
The InChIKey is HWDBCOFMAFANKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO.CH3F/c1-8-7-9(11(12)13)3-4-10(8)15-6-5-14-2;1-2/h3-4,7,11,14H,5-6H2,1-2H3;1H3.
What are the key properties of 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane?
2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane has a molecular weight of 249.28 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethyl)-2-methylphenoxy]-N-methylethanamine;fluoromethane is sourced from PubChem (CID 142886574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).