C12H20N2O — CID 116954340
1-(4-ethoxy-3-methylphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954340) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methylphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(4-ethoxy-3-methylphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954340 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-ethoxy-3-methylphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CCOc1ccc(C(NC)NC)cc1C |
| InChI | InChI=1S/C12H20N2O/c1-5-15-11-7-6-10(8-9(11)2)12(13-3)14-4/h6-8,12-14H,5H2,1-4H3 |
| InChIKey | PGXHILZHKGFTRH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|