C13H22N2O — CID 116948083
1-(4-ethoxy-3-methylphenyl)-1-N-methylpropane-1,2-diamine (PubChem CID 116948083) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methylphenyl)-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-(4-ethoxy-3-methylphenyl)-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 116948083 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-ethoxy-3-methylphenyl)-1-N-methylpropane-1,2-diamine |
| SMILES | CCOc1ccc(C(NC)C(C)N)cc1C |
| InChI | InChI=1S/C13H22N2O/c1-5-16-12-7-6-11(8-9(12)2)13(15-4)10(3)14/h6-8,10,13,15H,5,14H2,1-4H3 |
| InChIKey | TZVKADBLTZOQMG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |