C28H33FN4O — CID 142887247
N-[4-[(1Z)-buta-1,3-dienyl]-2-[(E)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-iminoprop-1-enyl]-5-methylphenyl]acetamide (PubChem CID 142887247) has the molecular formula C28H33FN4O and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[4-[(1Z)-buta-1,3-dienyl]-2-[(E)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-iminoprop-1-enyl]-5-methylphenyl]acetamide.
| Compound Name | N-[4-[(1Z)-buta-1,3-dienyl]-2-[(E)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-iminoprop-1-enyl]-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 142887247 |
| Molecular Formula | C28H33FN4O |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-[4-[(1Z)-buta-1,3-dienyl]-2-[(E)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-iminoprop-1-enyl]-5-methylphenyl]acetamide |
| SMILES | [H]/N=C(/C=C/c1cc(/C=C\C=C)c(C)cc1NC(C)=O)N1CCN(Cc2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C28H33FN4O/c1-5-6-7-24-17-25(27(16-20(24)2)31-22(4)34)10-13-28(30)33-15-14-32(18-21(33)3)19-23-8-11-26(29)12-9-23/h5-13,16-17,21,30H,1,14-15,18-19H2,2-4H3,(H,31,34)/b7-6-,13-10+,30-28-/t21-/m1/s1 |
| InChIKey | MQKFIOKIOVIBQE-OCHRICDISA-N |
| XLogP | 5.49 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|