About methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate
methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 14288736) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| PubChem CID | 14288736 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCC(C)N(C)C1 |
| InChI | InChI=1S/C9H15NO2/c1-7-4-5-8(6-10(7)2)9(11)12-3/h5,7H,4,6H2,1-3H3 |
| InChIKey | OMFQALCJDYAWAG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The IUPAC name of methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate (CID 14288736) is methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate.
What is the SMILES notation for methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The canonical SMILES for methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate is COC(=O)C1=CCC(C)N(C)C1.
What is the InChIKey of methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The InChIKey is OMFQALCJDYAWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-7-4-5-8(6-10(7)2)9(11)12-3/h5,7H,4,6H2,1-3H3.
What are the key properties of methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate?
methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate has a molecular weight of 169.22 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,2-dimethyl-3,6-dihydro-2H-pyridine-5-carboxylate is sourced from PubChem (CID 14288736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).