C10H12FN3 — CID 142887935
1-[(3E,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazol-3-amine (PubChem CID 142887935) has the molecular formula C10H12FN3 and a molecular weight of 193.22 g/mol. Its IUPAC name is 1-[(3E,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazol-3-amine.
| Compound Name | 1-[(3E,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 142887935 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-[(3E,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazol-3-amine |
| SMILES | C=C(F)/C(=C\C=C/C)n1ccc(N)n1 |
| InChI | InChI=1S/C10H12FN3/c1-3-4-5-9(8(2)11)14-7-6-10(12)13-14/h3-7H,2H2,1H3,(H2,12,13)/b4-3-,9-5+ |
| InChIKey | CJZNMWSYJXIDTR-XBURUKCPSA-N |
| XLogP | 2.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|