C18H27AsN4O9S — CID 142891258
2-amino-5-[[1-(carboxymethylamino)-3-[2-(2-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 142891258) has the molecular formula C18H27AsN4O9S and a molecular weight of 550.42 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142891258 |
| Molecular Formula | C18H27AsN4O9S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CSCC(=O)Nc1ccccc1[As](O)O)C(O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H27AsN4O9S/c20-11(18(29)30)5-6-14(24)23-13(17(28)21-7-16(26)27)8-33-9-15(25)22-12-4-2-1-3-10(12)19(31)32/h1-4,11,13,17,21,28,31-32H,5-9,20H2,(H,22,25)(H,23,24)(H,26,27)(H,29,30) |
| InChIKey | FJHHRCNPYOYNNL-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 231.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|