C22H33NO3 — CID 142892378
benzyl 1-butan-2-yl-3-(oxan-4-ylamino)cyclopentane-1-carboxylate (PubChem CID 142892378) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is benzyl 1-butan-2-yl-3-(oxan-4-ylamino)cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-butan-2-yl-3-(oxan-4-ylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 142892378 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | benzyl 1-butan-2-yl-3-(oxan-4-ylamino)cyclopentane-1-carboxylate |
| SMILES | CCC(C)C1(C(=O)OCc2ccccc2)CCC(NC2CCOCC2)C1 |
| InChI | InChI=1S/C22H33NO3/c1-3-17(2)22(21(24)26-16-18-7-5-4-6-8-18)12-9-20(15-22)23-19-10-13-25-14-11-19/h4-8,17,19-20,23H,3,9-16H2,1-2H3 |
| InChIKey | VTAKTBWJQPRNRE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |