C17H24N2O4 — CID 118993050
benzyl N-[(2S)-1-(oxan-4-ylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 118993050) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(oxan-4-ylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(oxan-4-ylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 118993050 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | benzyl N-[(2S)-1-(oxan-4-ylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OCc1ccccc1)C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C17H24N2O4/c1-2-15(16(20)18-14-8-10-22-11-9-14)19-17(21)23-12-13-6-4-3-5-7-13/h3-7,14-15H,2,8-12H2,1H3,(H,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | ATQZHFAMPXUXFN-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |