C13H24O6 — CID 142892816
[(3aS,6S,7aS)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methanol (PubChem CID 142892816) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(3aS,6S,7aS)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methanol.
| Compound Name | [(3aS,6S,7aS)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methanol |
|---|---|
| PubChem CID | 142892816 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [(3aS,6S,7aS)-6-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methanol |
| SMILES | COC(C)(C)O[C@@H]1CO[C@@]2(CO)OC(C)(C)O[C@H]2C1 |
| InChI | InChI=1S/C13H24O6/c1-11(2,15-5)17-9-6-10-13(8-14,16-7-9)19-12(3,4)18-10/h9-10,14H,6-8H2,1-5H3/t9-,10-,13-/m0/s1 |
| InChIKey | UPLFRRFWTXTTGP-KWBADKCTSA-N |
| XLogP | 1.01 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|