C6H11NS2 — CID 14289429
5-ethyl-3-methyl-1,3-thiazolidine-2-thione (PubChem CID 14289429) has the molecular formula C6H11NS2 and a molecular weight of 161.29 g/mol. Its IUPAC name is 5-ethyl-3-methyl-1,3-thiazolidine-2-thione.
| Compound Name | 5-ethyl-3-methyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 14289429 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 5-ethyl-3-methyl-1,3-thiazolidine-2-thione |
| SMILES | CCC1CN(C)C(=S)S1 |
| InChI | InChI=1S/C6H11NS2/c1-3-5-4-7(2)6(8)9-5/h5H,3-4H2,1-2H3 |
| InChIKey | CUCSAOSTFKTQJY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|