C6H11NS2 — CID 139054563
(4S,5R)-3,4,5-trimethyl-1,3-thiazolidine-2-thione (PubChem CID 139054563) has the molecular formula C6H11NS2 and a molecular weight of 161.29 g/mol. Its IUPAC name is (4S,5R)-3,4,5-trimethyl-1,3-thiazolidine-2-thione.
| Compound Name | (4S,5R)-3,4,5-trimethyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 139054563 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | (4S,5R)-3,4,5-trimethyl-1,3-thiazolidine-2-thione |
| SMILES | C[C@H]1SC(=S)N(C)[C@H]1C |
| InChI | InChI=1S/C6H11NS2/c1-4-5(2)9-6(8)7(4)3/h4-5H,1-3H3/t4-,5+/m0/s1 |
| InChIKey | PAZYGKOHGQRPSG-CRCLSJGQSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|