C7H15NS — CID 18723724
2,3,4,5-tetramethyl-1,3-thiazolidine (PubChem CID 18723724) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1,3-thiazolidine.
| Compound Name | 2,3,4,5-tetramethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 18723724 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,3,4,5-tetramethyl-1,3-thiazolidine |
| SMILES | CC1SC(C)N(C)C1C |
| InChI | InChI=1S/C7H15NS/c1-5-6(2)9-7(3)8(5)4/h5-7H,1-4H3 |
| InChIKey | FMZRAWJVZJUVLG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |