C26H42O6 — CID 142894723
ethane;[(10S)-7-methoxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate;methoxymethane (PubChem CID 142894723) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is ethane;[(10S)-7-methoxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate;methoxymethane.
| Compound Name | ethane;[(10S)-7-methoxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate;methoxymethane |
|---|---|
| PubChem CID | 142894723 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | ethane;[(10S)-7-methoxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate;methoxymethane |
| SMILES | CC.COC.COC(=O)OC1CC[C@@]2(C)C(=CC(OC)C3C2=CCC2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C22H30O5.C2H6O.C2H6/c1-21-9-7-14(27-20(24)26-4)11-13(21)12-17(25-3)19-15-5-6-18(23)22(15,2)10-8-16(19)21;1-3-2;1-2/h8,12,14-15,17,19H,5-7,9-11H2,1-4H3;1-2H3;1-2H3/t14?,15?,17?,19?,21-,22?;;/m0../s1 |
| InChIKey | YLXAYARGWWVPCR-DRCHXUKLSA-N |
| XLogP | 5.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|