C23H30O6 — CID 71210953
methyl (3S,7R,8R,10S,13S,14S)-3-(2-hydroxyacetyl)oxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate (PubChem CID 71210953) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl (3S,7R,8R,10S,13S,14S)-3-(2-hydroxyacetyl)oxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate.
| Compound Name | methyl (3S,7R,8R,10S,13S,14S)-3-(2-hydroxyacetyl)oxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate |
|---|---|
| PubChem CID | 71210953 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | methyl (3S,7R,8R,10S,13S,14S)-3-(2-hydroxyacetyl)oxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C=C2C[C@@H](OC(=O)CO)CC[C@]2(C)C2=CC[C@]3(C)C(=O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C23H30O6/c1-22-8-6-14(29-19(26)12-24)10-13(22)11-15(21(27)28-3)20-16-4-5-18(25)23(16,2)9-7-17(20)22/h7,11,14-16,20,24H,4-6,8-10,12H2,1-3H3/t14-,15+,16-,20-,22-,23-/m0/s1 |
| InChIKey | GKUGOLVJBFWABG-CGWZRCHNSA-N |
| XLogP | 2.74 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|