C14H27NO3 — CID 142896679
ethane;(E)-N-(2-hydroxy-2-methylpropyl)-3-(oxan-4-yl)prop-2-enamide (PubChem CID 142896679) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is ethane;(E)-N-(2-hydroxy-2-methylpropyl)-3-(oxan-4-yl)prop-2-enamide.
| Compound Name | ethane;(E)-N-(2-hydroxy-2-methylpropyl)-3-(oxan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 142896679 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethane;(E)-N-(2-hydroxy-2-methylpropyl)-3-(oxan-4-yl)prop-2-enamide |
| SMILES | CC.CC(C)(O)CNC(=O)/C=C/C1CCOCC1 |
| InChI | InChI=1S/C12H21NO3.C2H6/c1-12(2,15)9-13-11(14)4-3-10-5-7-16-8-6-10;1-2/h3-4,10,15H,5-9H2,1-2H3,(H,13,14);1-2H3/b4-3+; |
| InChIKey | UVAFTFCWJNNCPW-BJILWQEISA-N |
| XLogP | 1.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|