C24H28FN3 — CID 142897534
3-(4-fluoro-3-methylphenyl)-N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]propan-1-amine (PubChem CID 142897534) has the molecular formula C24H28FN3 and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenyl)-N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]propan-1-amine.
| Compound Name | 3-(4-fluoro-3-methylphenyl)-N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]propan-1-amine |
|---|---|
| PubChem CID | 142897534 |
| Molecular Formula | C24H28FN3 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 3-(4-fluoro-3-methylphenyl)-N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]propan-1-amine |
| SMILES | C=C/C=C(\C=C/C)C1=NNC(=C)C(C(=C)NCCCc2ccc(F)c(C)c2)=C1 |
| InChI | InChI=1S/C24H28FN3/c1-6-9-21(10-7-2)24-16-22(19(5)27-28-24)18(4)26-14-8-11-20-12-13-23(25)17(3)15-20/h6-7,9-10,12-13,15-16,26-27H,1,4-5,8,11,14H2,2-3H3/b10-7-,21-9+ |
| InChIKey | YZCXBXIBACIRLM-VQZDXTBYSA-N |
| XLogP | 5.26 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|