C16H19FN2 — CID 123788430
3-(4-fluoro-3-methylphenyl)-1-methyl-6-methylidene-5-propan-2-ylpyridazine (PubChem CID 123788430) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenyl)-1-methyl-6-methylidene-5-propan-2-ylpyridazine.
| Compound Name | 3-(4-fluoro-3-methylphenyl)-1-methyl-6-methylidene-5-propan-2-ylpyridazine |
|---|---|
| PubChem CID | 123788430 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-(4-fluoro-3-methylphenyl)-1-methyl-6-methylidene-5-propan-2-ylpyridazine |
| SMILES | C=C1C(C(C)C)=CC(c2ccc(F)c(C)c2)=NN1C |
| InChI | InChI=1S/C16H19FN2/c1-10(2)14-9-16(18-19(5)12(14)4)13-6-7-15(17)11(3)8-13/h6-10H,4H2,1-3,5H3 |
| InChIKey | HFAMUFBNBCNRSC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |