C19H24F3N3 — CID 142128290
ethane;1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine (PubChem CID 142128290) has the molecular formula C19H24F3N3 and a molecular weight of 351.42 g/mol. Its IUPAC name is ethane;1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine.
| Compound Name | ethane;1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine |
|---|---|
| PubChem CID | 142128290 |
| Molecular Formula | C19H24F3N3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethane;1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine |
| SMILES | C/C=C(C1=CC(c2ccccc2)=NNN1C)\C(=C/C)C(F)(F)F.CC |
| InChI | InChI=1S/C17H18F3N3.C2H6/c1-4-13(14(5-2)17(18,19)20)16-11-15(21-22-23(16)3)12-9-7-6-8-10-12;1-2/h4-11,22H,1-3H3;1-2H3/b13-4+,14-5+; |
| InChIKey | KQGVNDFJKPRHHZ-SBYRGWOTSA-N |
| XLogP | 5.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|