C20H23FN2 — CID 172578677
2-cyclohexa-1,5-dien-1-yl-3-ethenyl-4-(1-fluoropropyl)-5-phenyl-3,4-dihydropyrazole (PubChem CID 172578677) has the molecular formula C20H23FN2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-3-ethenyl-4-(1-fluoropropyl)-5-phenyl-3,4-dihydropyrazole.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-3-ethenyl-4-(1-fluoropropyl)-5-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 172578677 |
| Molecular Formula | C20H23FN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-3-ethenyl-4-(1-fluoropropyl)-5-phenyl-3,4-dihydropyrazole |
| SMILES | C=CC1C(C(F)CC)C(c2ccccc2)=NN1C1=CCCC=C1 |
| InChI | InChI=1S/C20H23FN2/c1-3-17(21)19-18(4-2)23(16-13-9-6-10-14-16)22-20(19)15-11-7-5-8-12-15/h4-5,7-9,11-14,17-19H,2-3,6,10H2,1H3 |
| InChIKey | NFBGZLDUKYPODA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|