C16H22N2V — CID 144892994
[(2E,4E)-4-[azanidylidene(phenyl)methyl]hexa-2,4-dien-3-yl]-methylazanide;ethane;vanadium(2+) (PubChem CID 144892994) has the molecular formula C16H22N2V and a molecular weight of 293.31 g/mol. Its IUPAC name is [(2E,4E)-4-[azanidylidene(phenyl)methyl]hexa-2,4-dien-3-yl]-methylazanide;ethane;vanadium(2+).
| Compound Name | [(2E,4E)-4-[azanidylidene(phenyl)methyl]hexa-2,4-dien-3-yl]-methylazanide;ethane;vanadium(2+) |
|---|---|
| PubChem CID | 144892994 |
| Molecular Formula | C16H22N2V |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [(2E,4E)-4-[azanidylidene(phenyl)methyl]hexa-2,4-dien-3-yl]-methylazanide;ethane;vanadium(2+) |
| SMILES | C/C=C([N-]C)\C(=C/C)C(=[N-])c1ccccc1.CC.[V+2] |
| InChI | InChI=1S/C14H16N2.C2H6.V/c1-4-12(13(5-2)16-3)14(15)11-9-7-6-8-10-11;1-2;/h4-10H,1-3H3;1-2H3;/q-2;;+2/b12-4+,13-5+;; |
| InChIKey | OEWQEYOQPWNEFO-SRVGNKHJSA-N |
| XLogP | 4.92 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|