C19H28F2N2 — CID 143117277
4-[[1-(2,4-difluorophenyl)ethylideneamino]methyl]-N-methyl-N-propylhex-1-en-2-amine (PubChem CID 143117277) has the molecular formula C19H28F2N2 and a molecular weight of 322.44 g/mol. Its IUPAC name is 4-[[1-(2,4-difluorophenyl)ethylideneamino]methyl]-N-methyl-N-propylhex-1-en-2-amine.
| Compound Name | 4-[[1-(2,4-difluorophenyl)ethylideneamino]methyl]-N-methyl-N-propylhex-1-en-2-amine |
|---|---|
| PubChem CID | 143117277 |
| Molecular Formula | C19H28F2N2 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-[[1-(2,4-difluorophenyl)ethylideneamino]methyl]-N-methyl-N-propylhex-1-en-2-amine |
| SMILES | C=C(CC(CC)C/N=C(\C)c1ccc(F)cc1F)N(C)CCC |
| InChI | InChI=1S/C19H28F2N2/c1-6-10-23(5)14(3)11-16(7-2)13-22-15(4)18-9-8-17(20)12-19(18)21/h8-9,12,16H,3,6-7,10-11,13H2,1-2,4-5H3/b22-15+ |
| InChIKey | RFIDFCONNRVOOP-PXLXIMEGSA-N |
| XLogP | 5.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|