C13H16F2N2 — CID 89080293
(2,4-difluorophenyl)-(1-methylpiperidin-4-yl)methanimine (PubChem CID 89080293) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(1-methylpiperidin-4-yl)methanimine.
| Compound Name | (2,4-difluorophenyl)-(1-methylpiperidin-4-yl)methanimine |
|---|---|
| PubChem CID | 89080293 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2,4-difluorophenyl)-(1-methylpiperidin-4-yl)methanimine |
| SMILES | [H]/N=C(/c1ccc(F)cc1F)C1CCN(C)CC1 |
| InChI | InChI=1S/C13H16F2N2/c1-17-6-4-9(5-7-17)13(16)11-3-2-10(14)8-12(11)15/h2-3,8-9,16H,4-7H2,1H3/b16-13+ |
| InChIKey | JPPVFQVMGLDDIZ-DTQAZKPQSA-N |
| XLogP | 2.67 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|