C29H40FN — CID 123203376
6-[4-(2-fluoro-3-methylphenyl)-2,7,7-trimethylocta-3,5-dien-3-yl]-3-methylidene-2-pentyl-4H-pyridine (PubChem CID 123203376) has the molecular formula C29H40FN and a molecular weight of 421.64 g/mol. Its IUPAC name is 6-[4-(2-fluoro-3-methylphenyl)-2,7,7-trimethylocta-3,5-dien-3-yl]-3-methylidene-2-pentyl-4H-pyridine.
| Compound Name | 6-[4-(2-fluoro-3-methylphenyl)-2,7,7-trimethylocta-3,5-dien-3-yl]-3-methylidene-2-pentyl-4H-pyridine |
|---|---|
| PubChem CID | 123203376 |
| Molecular Formula | C29H40FN |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 6-[4-(2-fluoro-3-methylphenyl)-2,7,7-trimethylocta-3,5-dien-3-yl]-3-methylidene-2-pentyl-4H-pyridine |
| SMILES | C=C1CC=C(C(=C(C=CC(C)(C)C)c2cccc(C)c2F)C(C)C)N=C1CCCCC |
| InChI | InChI=1S/C29H40FN/c1-9-10-11-15-25-21(4)16-17-26(31-25)27(20(2)3)23(18-19-29(6,7)8)24-14-12-13-22(5)28(24)30/h12-14,17-20H,4,9-11,15-16H2,1-3,5-8H3 |
| InChIKey | GYBDLTIIURQHEZ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|