C17H16FN — CID 71191345
(7R)-8-fluoro-4,7-dimethyl-2-phenyl-6,7-dihydroquinoline (PubChem CID 71191345) has the molecular formula C17H16FN and a molecular weight of 253.32 g/mol. Its IUPAC name is (7R)-8-fluoro-4,7-dimethyl-2-phenyl-6,7-dihydroquinoline.
| Compound Name | (7R)-8-fluoro-4,7-dimethyl-2-phenyl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 71191345 |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (7R)-8-fluoro-4,7-dimethyl-2-phenyl-6,7-dihydroquinoline |
| SMILES | Cc1cc(-c2ccccc2)nc2c1=CC[C@@H](C)C=2F |
| InChI | InChI=1S/C17H16FN/c1-11-8-9-14-12(2)10-15(19-17(14)16(11)18)13-6-4-3-5-7-13/h3-7,9-11H,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | PFVWMYAKHKSGQX-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |