C21H24FN3 — CID 142904036
(1E,6Z)-N-[(Z)-[(2E)-2-(aminomethylidene)-1-(4-fluorophenyl)but-3-enylidene]amino]-N,7-dimethylcycloocta-1,4,6-trien-1-amine (PubChem CID 142904036) has the molecular formula C21H24FN3 and a molecular weight of 337.44 g/mol. Its IUPAC name is (1E,6Z)-N-[(Z)-[(2E)-2-(aminomethylidene)-1-(4-fluorophenyl)but-3-enylidene]amino]-N,7-dimethylcycloocta-1,4,6-trien-1-amine.
| Compound Name | (1E,6Z)-N-[(Z)-[(2E)-2-(aminomethylidene)-1-(4-fluorophenyl)but-3-enylidene]amino]-N,7-dimethylcycloocta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142904036 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (1E,6Z)-N-[(Z)-[(2E)-2-(aminomethylidene)-1-(4-fluorophenyl)but-3-enylidene]amino]-N,7-dimethylcycloocta-1,4,6-trien-1-amine |
| SMILES | C=CC(=C\N)/C(=N\N(C)/C1=C/CC=C/C=C(/C)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3/c1-4-17(15-23)21(18-10-12-19(22)13-11-18)24-25(3)20-9-7-5-6-8-16(2)14-20/h4-6,8-13,15H,1,7,14,23H2,2-3H3/b6-5?,16-8-,17-15+,20-9+,24-21+ |
| InChIKey | RRGUJAAKHROZML-XWGMSQQSSA-N |
| XLogP | 4.67 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|