C21H23FN2 — CID 142047554
(1Z,3E)-3-(3-fluorophenyl)-N-[(E)-[(3E,5Z)-3-methylocta-3,5,7-trien-2-ylidene]amino]hexa-1,3,5-trien-1-amine (PubChem CID 142047554) has the molecular formula C21H23FN2 and a molecular weight of 322.43 g/mol. Its IUPAC name is (1Z,3E)-3-(3-fluorophenyl)-N-[(E)-[(3E,5Z)-3-methylocta-3,5,7-trien-2-ylidene]amino]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(3-fluorophenyl)-N-[(E)-[(3E,5Z)-3-methylocta-3,5,7-trien-2-ylidene]amino]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 142047554 |
| Molecular Formula | C21H23FN2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (1Z,3E)-3-(3-fluorophenyl)-N-[(E)-[(3E,5Z)-3-methylocta-3,5,7-trien-2-ylidene]amino]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C=C(C)\C(C)=N\N/C=C\C(=C/C=C)c1cccc(F)c1 |
| InChI | InChI=1S/C21H23FN2/c1-5-7-8-11-17(3)18(4)24-23-15-14-19(10-6-2)20-12-9-13-21(22)16-20/h5-16,23H,1-2H2,3-4H3/b8-7-,15-14-,17-11+,19-10+,24-18+ |
| InChIKey | PNVVPPNXLCFNGJ-KSGSNICYSA-N |
| XLogP | 5.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|