C21H25FN2 — CID 91566482
4-[4-(4-fluorophenyl)butyl]-3,7-dimethyl-5,6-dihydro-1H-cycloocta[c]pyrazole (PubChem CID 91566482) has the molecular formula C21H25FN2 and a molecular weight of 324.44 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)butyl]-3,7-dimethyl-5,6-dihydro-1H-cycloocta[c]pyrazole.
| Compound Name | 4-[4-(4-fluorophenyl)butyl]-3,7-dimethyl-5,6-dihydro-1H-cycloocta[c]pyrazole |
|---|---|
| PubChem CID | 91566482 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-[4-(4-fluorophenyl)butyl]-3,7-dimethyl-5,6-dihydro-1H-cycloocta[c]pyrazole |
| SMILES | CC1=CC=c2[nH]nc(C)c2=C(CCCCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25FN2/c1-15-7-11-18(21-16(2)23-24-20(21)14-8-15)6-4-3-5-17-9-12-19(22)13-10-17/h8-10,12-14,24H,3-7,11H2,1-2H3 |
| InChIKey | QEGXNYCDBXFHKZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|