C12H21N5 — CID 142899561
ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine (PubChem CID 142899561) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine.
| Compound Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 142899561 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine |
| SMILES | C=C/C(=C\C=C/C)n1nc(NC)nc1N.CC |
| InChI | InChI=1S/C10H15N5.C2H6/c1-4-6-7-8(5-2)15-9(11)13-10(12-3)14-15;1-2/h4-7H,2H2,1,3H3,(H3,11,12,13,14);1-2H3/b6-4-,8-7+; |
| InChIKey | MQDZHBDSNHFCDL-KXMXVLADSA-N |
| XLogP | 2.53 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|