C12H22N6 — CID 142899496
1-[(1Z)-1-aminohepta-1,4,6-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine;ethane (PubChem CID 142899496) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-[(1Z)-1-aminohepta-1,4,6-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine;ethane.
| Compound Name | 1-[(1Z)-1-aminohepta-1,4,6-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine;ethane |
|---|---|
| PubChem CID | 142899496 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-[(1Z)-1-aminohepta-1,4,6-trien-3-yl]-3-N-methyl-1,2,4-triazole-3,5-diamine;ethane |
| SMILES | C=CC=CC(/C=C\N)n1nc(NC)nc1N.CC |
| InChI | InChI=1S/C10H16N6.C2H6/c1-3-4-5-8(6-7-11)16-9(12)14-10(13-2)15-16;1-2/h3-8H,1,11H2,2H3,(H3,12,13,14,15);1-2H3/b5-4?,7-6-; |
| InChIKey | LZAFIAZDTLOZOK-UKUGUQEQSA-N |
| XLogP | 1.68 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|