C10H16N4 — CID 143413741
(5E)-N-methyl-6-(1,2,4-triazol-1-yl)hepta-1,5-dien-3-amine (PubChem CID 143413741) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (5E)-N-methyl-6-(1,2,4-triazol-1-yl)hepta-1,5-dien-3-amine.
| Compound Name | (5E)-N-methyl-6-(1,2,4-triazol-1-yl)hepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 143413741 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (5E)-N-methyl-6-(1,2,4-triazol-1-yl)hepta-1,5-dien-3-amine |
| SMILES | C=CC(C/C=C(\C)n1cncn1)NC |
| InChI | InChI=1S/C10H16N4/c1-4-10(11-3)6-5-9(2)14-8-12-7-13-14/h4-5,7-8,10-11H,1,6H2,2-3H3/b9-5+ |
| InChIKey | NYMYIYHUURIAGP-WEVVVXLNSA-N |
| XLogP | 1.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|