C10H16N4 — CID 143413627
(2Z,4E)-N-methyl-4-(1,2,4-triazol-1-yl)hepta-2,4-dien-1-amine (PubChem CID 143413627) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (2Z,4E)-N-methyl-4-(1,2,4-triazol-1-yl)hepta-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-N-methyl-4-(1,2,4-triazol-1-yl)hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143413627 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2Z,4E)-N-methyl-4-(1,2,4-triazol-1-yl)hepta-2,4-dien-1-amine |
| SMILES | CC/C=C(\C=C/CNC)n1cncn1 |
| InChI | InChI=1S/C10H16N4/c1-3-5-10(6-4-7-11-2)14-9-12-8-13-14/h4-6,8-9,11H,3,7H2,1-2H3/b6-4-,10-5+ |
| InChIKey | IZRODUWUHFBQTL-KNVSICBPSA-N |
| XLogP | 1.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|