C10H16N4 — CID 143922029
(2E)-4-(1,2,4-triazol-1-yl)octa-2,7-dien-1-amine (PubChem CID 143922029) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (2E)-4-(1,2,4-triazol-1-yl)octa-2,7-dien-1-amine.
| Compound Name | (2E)-4-(1,2,4-triazol-1-yl)octa-2,7-dien-1-amine |
|---|---|
| PubChem CID | 143922029 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2E)-4-(1,2,4-triazol-1-yl)octa-2,7-dien-1-amine |
| SMILES | C=CCCC(/C=C/CN)n1cncn1 |
| InChI | InChI=1S/C10H16N4/c1-2-3-5-10(6-4-7-11)14-9-12-8-13-14/h2,4,6,8-10H,1,3,5,7,11H2/b6-4+ |
| InChIKey | LMSIXRBTTIDQDZ-GQCTYLIASA-N |
| XLogP | 1.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|