C8H15ClN4 — CID 174778847
3-(1,2,4-triazol-1-yl)hex-2-en-1-amine;hydrochloride (PubChem CID 174778847) has the molecular formula C8H15ClN4 and a molecular weight of 202.69 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)hex-2-en-1-amine;hydrochloride.
| Compound Name | 3-(1,2,4-triazol-1-yl)hex-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174778847 |
| Molecular Formula | C8H15ClN4 |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)hex-2-en-1-amine;hydrochloride |
| SMILES | CCCC(=CCN)n1cncn1.Cl |
| InChI | InChI=1S/C8H14N4.ClH/c1-2-3-8(4-5-9)12-7-10-6-11-12;/h4,6-7H,2-3,5,9H2,1H3;1H |
| InChIKey | IFBBNPGMQQYTQT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |