C11H15FN6O — CID 69382461
(3-fluoro-5-hexyl-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone (PubChem CID 69382461) has the molecular formula C11H15FN6O and a molecular weight of 266.28 g/mol. Its IUPAC name is (3-fluoro-5-hexyl-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone.
| Compound Name | (3-fluoro-5-hexyl-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69382461 |
| Molecular Formula | C11H15FN6O |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (3-fluoro-5-hexyl-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone |
| SMILES | CCCCCCc1nc(F)nn1C(=O)n1cncn1 |
| InChI | InChI=1S/C11H15FN6O/c1-2-3-4-5-6-9-15-10(12)16-18(9)11(19)17-8-13-7-14-17/h7-8H,2-6H2,1H3 |
| InChIKey | IGLMMZDRJKBIIA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|