C12H15F3N6O — CID 69382735
[3-hexyl-5-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 69382735) has the molecular formula C12H15F3N6O and a molecular weight of 316.29 g/mol. Its IUPAC name is [3-hexyl-5-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [3-hexyl-5-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69382735 |
| Molecular Formula | C12H15F3N6O |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [3-hexyl-5-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | CCCCCCc1nc(C(F)(F)F)n(C(=O)n2cncn2)n1 |
| InChI | InChI=1S/C12H15F3N6O/c1-2-3-4-5-6-9-18-10(12(13,14)15)21(19-9)11(22)20-8-16-7-17-20/h7-8H,2-6H2,1H3 |
| InChIKey | MOLNNEWNOFXAEL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|