C12H15N7O — CID 69384641
5-hexyl-1-(1,2,4-triazole-1-carbonyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 69384641) has the molecular formula C12H15N7O and a molecular weight of 273.30 g/mol. Its IUPAC name is 5-hexyl-1-(1,2,4-triazole-1-carbonyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 5-hexyl-1-(1,2,4-triazole-1-carbonyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 69384641 |
| Molecular Formula | C12H15N7O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-hexyl-1-(1,2,4-triazole-1-carbonyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCCCCc1nc(C#N)nn1C(=O)n1cncn1 |
| InChI | InChI=1S/C12H15N7O/c1-2-3-4-5-6-11-16-10(7-13)17-19(11)12(20)18-9-14-8-15-18/h8-9H,2-6H2,1H3 |
| InChIKey | AGNMWPRTGDHSFY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|