C12H13F5N6O — CID 87804434
[5-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 87804434) has the molecular formula C12H13F5N6O and a molecular weight of 352.27 g/mol. Its IUPAC name is [5-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [5-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 87804434 |
| Molecular Formula | C12H13F5N6O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [5-(2,2-dimethylpropyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | CC(C)(C)Cc1nc(C(F)(F)C(F)(F)F)nn1C(=O)n1cncn1 |
| InChI | InChI=1S/C12H13F5N6O/c1-10(2,3)4-7-20-8(11(13,14)12(15,16)17)21-23(7)9(24)22-6-18-5-19-22/h5-6H,4H2,1-3H3 |
| InChIKey | BWNUCGBHHBDMMG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|