C14H9Cl5N6O — CID 69382464
[5-benzyl-3-(1,1,2,2,2-pentachloroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 69382464) has the molecular formula C14H9Cl5N6O and a molecular weight of 454.53 g/mol. Its IUPAC name is [5-benzyl-3-(1,1,2,2,2-pentachloroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [5-benzyl-3-(1,1,2,2,2-pentachloroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69382464 |
| Molecular Formula | C14H9Cl5N6O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 451.93 |
| IUPAC Name | [5-benzyl-3-(1,1,2,2,2-pentachloroethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | O=C(n1cncn1)n1nc(C(Cl)(Cl)C(Cl)(Cl)Cl)nc1Cc1ccccc1 |
| InChI | InChI=1S/C14H9Cl5N6O/c15-13(16,14(17,18)19)11-22-10(6-9-4-2-1-3-5-9)25(23-11)12(26)24-8-20-7-21-24/h1-5,7-8H,6H2 |
| InChIKey | YNIJWOICKCSBBZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|