C6H11ClN4S — CID 142638721
2-(1,2,4-triazol-1-yl)butanethioamide;hydrochloride (PubChem CID 142638721) has the molecular formula C6H11ClN4S and a molecular weight of 206.70 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)butanethioamide;hydrochloride.
| Compound Name | 2-(1,2,4-triazol-1-yl)butanethioamide;hydrochloride |
|---|---|
| PubChem CID | 142638721 |
| Molecular Formula | C6H11ClN4S |
| Molecular Weight | 206.70 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)butanethioamide;hydrochloride |
| SMILES | CCC(C(N)=S)n1cncn1.Cl |
| InChI | InChI=1S/C6H10N4S.ClH/c1-2-5(6(7)11)10-4-8-3-9-10;/h3-5H,2H2,1H3,(H2,7,11);1H |
| InChIKey | ZRXLYRBZIRXUNK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.70 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|