C7H12N4OS — CID 142091668
(2R)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanethioamide (PubChem CID 142091668) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanethioamide.
| Compound Name | (2R)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 142091668 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (2R)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanethioamide |
| SMILES | C[C@@H](C(N)=S)C(O)Cn1cncn1 |
| InChI | InChI=1S/C7H12N4OS/c1-5(7(8)13)6(12)2-11-4-9-3-10-11/h3-6,12H,2H2,1H3,(H2,8,13)/t5-,6?/m1/s1 |
| InChIKey | RWQLXELGMHAUBQ-LWOQYNTDSA-N |
| XLogP | -0.44 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|