2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid

C6H8N4O4 — CID 155012654

IUPAC2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESNC(=O)OC(Cn1cncn1)C(=O)O
InChIInChI=1S/C6H8N4O4/c7-6(13)14-4(5(11)12)1-10-3-8-2-9-10/h2-4H,1H2,(H2,7,13)(H,11,12)
InChIKeyTVGWWSATDKJJLV-UHFFFAOYSA-N
MW200.15 g/mol
LogP-1.17
Rot. Bonds4

About 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid

2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid (PubChem CID 155012654) has the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid.

Molecular Properties

Compound Name2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid
PubChem CID155012654
Molecular FormulaC6H8N4O4
Molecular Weight200.15 g/mol
Exact Mass200.05
IUPAC Name2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESNC(=O)OC(Cn1cncn1)C(=O)O
InChIInChI=1S/C6H8N4O4/c7-6(13)14-4(5(11)12)1-10-3-8-2-9-10/h2-4H,1H2,(H2,7,13)(H,11,12)
InChIKeyTVGWWSATDKJJLV-UHFFFAOYSA-N
XLogP-1.17
TPSA120.33 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.15
LogP ≤ 5-1.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid (CID 155012654) is 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid is NC(=O)OC(Cn1cncn1)C(=O)O.
What is the InChIKey of 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is TVGWWSATDKJJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4/c7-6(13)14-4(5(11)12)1-10-3-8-2-9-10/h2-4H,1H2,(H2,7,13)(H,11,12).
What are the key properties of 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid?
2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 200.15 g/mol, XLogP of -1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyloxy-3-(1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 155012654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).