About N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide
N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide (PubChem CID 57081414) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide |
| PubChem CID | 57081414 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide |
| SMILES | CC(O)NC(=O)n1cncn1 |
| InChI | InChI=1S/C5H8N4O2/c1-4(10)8-5(11)9-3-6-2-7-9/h2-4,10H,1H3,(H,8,11) |
| InChIKey | BMQWMKXSLJGQKB-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide?
The IUPAC name of N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide (CID 57081414) is N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide?
The canonical SMILES for N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide is CC(O)NC(=O)n1cncn1.
What is the InChIKey of N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide?
The InChIKey is BMQWMKXSLJGQKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c1-4(10)8-5(11)9-3-6-2-7-9/h2-4,10H,1H3,(H,8,11).
What are the key properties of N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide?
N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide has a molecular weight of 156.15 g/mol, XLogP of -0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxyethyl)-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 57081414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).