C3H3N3O3 — CID 101006076
1,2,4-triazole-1-carboperoxoic acid (PubChem CID 101006076) has the molecular formula C3H3N3O3 and a molecular weight of 129.08 g/mol. Its IUPAC name is 1,2,4-triazole-1-carboperoxoic acid.
| Compound Name | 1,2,4-triazole-1-carboperoxoic acid |
|---|---|
| PubChem CID | 101006076 |
| Molecular Formula | C3H3N3O3 |
| Molecular Weight | 129.08 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | 1,2,4-triazole-1-carboperoxoic acid |
| SMILES | O=C(OO)n1cncn1 |
| InChI | InChI=1S/C3H3N3O3/c7-3(9-8)6-2-4-1-5-6/h1-2,8H |
| InChIKey | YIWIUHRFOAHRNE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.08 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|