C10H9N3O — CID 172733001
(3-methylphenyl)-(1,2,4-triazol-1-yl)methanone (PubChem CID 172733001) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is (3-methylphenyl)-(1,2,4-triazol-1-yl)methanone.
| Compound Name | (3-methylphenyl)-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 172733001 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (3-methylphenyl)-(1,2,4-triazol-1-yl)methanone |
| SMILES | Cc1cccc(C(=O)n2cncn2)c1 |
| InChI | InChI=1S/C10H9N3O/c1-8-3-2-4-9(5-8)10(14)13-7-11-6-12-13/h2-7H,1H3 |
| InChIKey | IAWMQDAEQQJNEB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |