C8H13N5O2 — CID 82018797
tert-butyl (NE)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate (PubChem CID 82018797) has the molecular formula C8H13N5O2 and a molecular weight of 211.23 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate |
|---|---|
| PubChem CID | 82018797 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | tert-butyl (NE)-N-[amino(1,2,4-triazol-1-yl)methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\N)n1cncn1 |
| InChI | InChI=1S/C8H13N5O2/c1-8(2,3)15-7(14)12-6(9)13-5-10-4-11-13/h4-5H,1-3H3,(H2,9,12,14) |
| InChIKey | SKSIGJGFRUKGOA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|