C17H28N4O5 — CID 23232380
tert-butyl N-(2-methoxyethyl)-N-[(Z)-N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate (PubChem CID 23232380) has the molecular formula C17H28N4O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-[(Z)-N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-[(Z)-N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 23232380 |
| Molecular Formula | C17H28N4O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-[(Z)-N-[(2-methylpropan-2-yl)oxycarbonyl]-C-pyrazol-1-ylcarbonimidoyl]carbamate |
| SMILES | COCCN(C(=O)OC(C)(C)C)/C(=N/C(=O)OC(C)(C)C)n1cccn1 |
| InChI | InChI=1S/C17H28N4O5/c1-16(2,3)25-14(22)19-13(21-10-8-9-18-21)20(11-12-24-7)15(23)26-17(4,5)6/h8-10H,11-12H2,1-7H3/b19-13- |
| InChIKey | AODQYBBVWFQAHM-UYRXBGFRSA-N |
| XLogP | 2.91 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|