C14H22N4O4 — CID 175690884
[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyrazol-1-ylpropylidene]carbamic acid (PubChem CID 175690884) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyrazol-1-ylpropylidene]carbamic acid.
| Compound Name | [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyrazol-1-ylpropylidene]carbamic acid |
|---|---|
| PubChem CID | 175690884 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyrazol-1-ylpropylidene]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)C(=NC(=O)O)n1cccn1 |
| InChI | InChI=1S/C14H22N4O4/c1-13(2,3)22-12(21)15-9-14(4,5)10(17-11(19)20)18-8-6-7-16-18/h6-8H,9H2,1-5H3,(H,15,21)(H,19,20) |
| InChIKey | AZDBYBLRJLDUSC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|