C14H22N4O4 — CID 68974676
tert-butyl N-(N-butoxycarbonyl-C-pyrazol-1-ylcarbonimidoyl)carbamate (PubChem CID 68974676) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl N-(N-butoxycarbonyl-C-pyrazol-1-ylcarbonimidoyl)carbamate.
| Compound Name | tert-butyl N-(N-butoxycarbonyl-C-pyrazol-1-ylcarbonimidoyl)carbamate |
|---|---|
| PubChem CID | 68974676 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | tert-butyl N-(N-butoxycarbonyl-C-pyrazol-1-ylcarbonimidoyl)carbamate |
| SMILES | CCCCOC(=O)N=C(NC(=O)OC(C)(C)C)n1cccn1 |
| InChI | InChI=1S/C14H22N4O4/c1-5-6-10-21-12(19)16-11(18-9-7-8-15-18)17-13(20)22-14(2,3)4/h7-9H,5-6,10H2,1-4H3,(H,16,17,19,20) |
| InChIKey | BNCVLAQWUYMUDN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|