C18H28N4O6 — CID 139935508
[1-[(2-methylpropan-2-yl)oxy]-1-oxo-2-(pyrazole-1-carboximidoylcarbamoyloxy)propan-2-yl] hexanoate (PubChem CID 139935508) has the molecular formula C18H28N4O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is [1-[(2-methylpropan-2-yl)oxy]-1-oxo-2-(pyrazole-1-carboximidoylcarbamoyloxy)propan-2-yl] hexanoate.
| Compound Name | [1-[(2-methylpropan-2-yl)oxy]-1-oxo-2-(pyrazole-1-carboximidoylcarbamoyloxy)propan-2-yl] hexanoate |
|---|---|
| PubChem CID | 139935508 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [1-[(2-methylpropan-2-yl)oxy]-1-oxo-2-(pyrazole-1-carboximidoylcarbamoyloxy)propan-2-yl] hexanoate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(OC(=O)CCCCC)C(=O)OC(C)(C)C)n1cccn1 |
| InChI | InChI=1S/C18H28N4O6/c1-6-7-8-10-13(23)26-18(5,14(24)27-17(2,3)4)28-16(25)21-15(19)22-12-9-11-20-22/h9,11-12H,6-8,10H2,1-5H3,(H2,19,21,25) |
| InChIKey | YJBQLMBAVFBOMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|